CAS 1188228-09-2 is the registry number for 2-(Chloromethyl)-6-ethylbenzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-6-ethyl-1,3-benzothiazole (CAS 1188228-09-2) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 2-(chloromethyl)-6-ethyl-1,3-benzothiazole. InChIKey: QBYIYSCMNRJSTI-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 2-(chloromethyl)-6-ethyl-1,3-benzothiazole |
| InChIKey | QBYIYSCMNRJSTI-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)N=C(S2)CCl |
Computed by PubChem (NCBI)