CAS 1185065-26-2 is the registry number for 2-(Thiophen-3-yl)aniline hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-thiophen-3-ylaniline;hydrochloride (CAS 1185065-26-2) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 2-thiophen-3-ylaniline;hydrochloride. InChIKey: HLQVRTCJFDGRNB-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 2-thiophen-3-ylaniline;hydrochloride |
| InChIKey | HLQVRTCJFDGRNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC=C2)N.Cl |
Computed by PubChem (NCBI)