CAS 274918-15-9 appears in our catalog under these names: 2–(5–Chloro–1–benzothiophen–3–yl)ethan–1–amine, 2-(5-Chloro-1-benzothiophen-3-yl)ethan-1-amine 95%, 2-(5-Chloro-1-benzothiophen-3-yl)ethan-1-amine, 95%, 95%, 5-Chlorobenzo[b]thiophene-3-ethanamine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(5-chloro-1-benzothiophen-3-yl)ethanamine (CAS 274918-15-9) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 2-(5-chloro-1-benzothiophen-3-yl)ethanamine. InChIKey: QTODCBPICKEITJ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 2-(5-chloro-1-benzothiophen-3-yl)ethanamine |
| InChIKey | QTODCBPICKEITJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CS2)CCN |
Computed by PubChem (NCBI)