CAS 1172363-16-4 is the registry number for 4-(Thien-2-yl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-thiophen-2-ylaniline;hydrochloride (CAS 1172363-16-4) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 4-thiophen-2-ylaniline;hydrochloride. InChIKey: YZNMSSXLTNKKRH-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 4-thiophen-2-ylaniline;hydrochloride |
| InChIKey | YZNMSSXLTNKKRH-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)