CAS 1188031-79-9 is the registry number for 2-(Chloromethyl)-4,7-dimethylbenzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-4,7-dimethyl-1,3-benzothiazole (CAS 1188031-79-9) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 2-(chloromethyl)-4,7-dimethyl-1,3-benzothiazole. InChIKey: HSSUAOWAGAWBJG-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 2-(chloromethyl)-4,7-dimethyl-1,3-benzothiazole |
| InChIKey | HSSUAOWAGAWBJG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C)SC(=N2)CCl |
Computed by PubChem (NCBI)