CAS 1803598-86-8 appears in our catalog under these names: 4-(thiophen-3-yl)aniline hydrochloride, 95%, 4-(Thiophen-3-yl)aniline hydrochloride, 97%, 4-(Thiophen-3-yl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-thiophen-3-ylaniline;hydrochloride (CAS 1803598-86-8) is a chemical compound with the molecular formula C10H10ClNS and a molecular weight of 211.71 g/mol. IUPAC name: 4-thiophen-3-ylaniline;hydrochloride. InChIKey: RJUPXFCNTFUHII-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNS |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 4-thiophen-3-ylaniline;hydrochloride |
| InChIKey | RJUPXFCNTFUHII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC=C2)N.Cl |
Computed by PubChem (NCBI)