Products 1087784-31-3
CAS 1087784-31-3 appears in our catalog under these names: 1-(2-Aminophenyl)-1,5-dihydro-4h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 1-(2-Aminophenyl)-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2-aminophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1087784-31-3) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 1-(2-aminophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: STJKZRWNDZEFGO-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-(2-aminophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | STJKZRWNDZEFGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)