CAS 51802-29-0 is the registry number for N-(2-Amino-1,2-dinitrilovinyl)(phenylamino)formamide. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-phenylurea (CAS 51802-29-0) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-phenylurea. InChIKey: RNAYXSOGFOWMON-KTKRTIGZSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-phenylurea |
| InChIKey | RNAYXSOGFOWMON-KTKRTIGZSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)