CAS 21324-31-2 is the registry number for 3-Benzyl-3H-(1,2,3)triazolo(4,5-d)pyrimidin-7-ol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one (CAS 21324-31-2) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one. InChIKey: GKILZMOZUNSGBZ-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-benzyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| InChIKey | GKILZMOZUNSGBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C(=O)NC=N3)N=N2 |
Computed by PubChem (NCBI)