CAS 69923-95-1 appears in our catalog under these names: 5-Amino-1-phenyl-1,5-dihydro-4h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 5-Amino-1-phenyl-1H-pyrazolo(3,4-d)pyrimidin-4(5H)-one, 98%, 5-Amino-1-phenyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-amino-1-phenylpyrazolo[5,4-d]pyrimidin-4-one (CAS 69923-95-1) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 5-amino-1-phenylpyrazolo[5,4-d]pyrimidin-4-one. InChIKey: FYLIRLDTHRKSMI-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 5-amino-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | FYLIRLDTHRKSMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=N2)C(=O)N(C=N3)N |
Computed by PubChem (NCBI)