CAS 895842-41-8 is the registry number for 2-Amino-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 895842-41-8) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 2-amino-5-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: YDGIHHUDHWRDOH-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 2-amino-5-phenyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | YDGIHHUDHWRDOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)N3C(=N2)N=C(N3)N |
Computed by PubChem (NCBI)