CAS 1152906-45-0 is the registry number for 5-(1-Phenyl-1H-pyrazol-4-yl)-1,3,4-oxadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(1-phenylpyrazol-4-yl)-1,3,4-oxadiazol-2-amine (CAS 1152906-45-0) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 5-(1-phenylpyrazol-4-yl)-1,3,4-oxadiazol-2-amine. InChIKey: UFAYXMSSZGXPHZ-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 5-(1-phenylpyrazol-4-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | UFAYXMSSZGXPHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=N2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)