Products 1427870-28-7
CAS 1427870-28-7 is the registry number for 4-Cyano-N-(1-methyl-1H-1,2,4-triazol-5-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyano-N-(2-methyl-1,2,4-triazol-3-yl)benzamide (CAS 1427870-28-7) is a chemical compound with the molecular formula C11H9N5O and a molecular weight of 227.22 g/mol. IUPAC name: 4-cyano-N-(2-methyl-1,2,4-triazol-3-yl)benzamide. InChIKey: RIAQKEGQQXNHCU-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 4-cyano-N-(2-methyl-1,2,4-triazol-3-yl)benzamide |
| InChIKey | RIAQKEGQQXNHCU-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)NC(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)