CAS 108804-50-8 appears in our catalog under these names: 1-Acetyl-2,6-dihydroxynaphthalene, 95%, 1-Acetyl-2,6-dihydroxynaphthalene, 98+%, 1–Acetyl–2,6–dihydroxynaphthalene, 1-Acetyl-2,6-dihydroxynaphthalene, ≥97%, ≥97%, 1-(2,6-Dihydroxynaphthalen-1-yl)ethan-1-one, ≥97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
1-(2,6-dihydroxynaphthalen-1-yl)ethanone (CAS 108804-50-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 1-(2,6-dihydroxynaphthalen-1-yl)ethanone. InChIKey: BXEYIDZNPJQWFK-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 1-(2,6-dihydroxynaphthalen-1-yl)ethanone |
| InChIKey | BXEYIDZNPJQWFK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC2=C1C=CC(=C2)O)O |
Computed by PubChem (NCBI)