CAS 108937-87-7 appears in our catalog under these names: 4-Methoxyindoline-2,3-dione, 97%, 4–Methoxy–indoline–2,3–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 200mg.
4-methoxy-1H-indole-2,3-dione (CAS 108937-87-7) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 4-methoxy-1H-indole-2,3-dione. InChIKey: LTERBHLYBWXCPT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-methoxy-1H-indole-2,3-dione |
| InChIKey | LTERBHLYBWXCPT-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C(=O)N2 |
Computed by PubChem (NCBI)