Products 1092108-86-5
CAS 1092108-86-5 is the registry number for 3-(3,4-Difluorophenyl)pyrrolidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-difluorophenyl)pyrrolidine;hydrochloride (CAS 1092108-86-5) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 3-(3,4-difluorophenyl)pyrrolidine;hydrochloride. InChIKey: QTTGVUFVACDMJT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | QTTGVUFVACDMJT-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)