CAS 109224-70-6 appears in our catalog under these names: 4H,5H-Imidazo(1,2-a)quinazolin-5-one, 95%, 4H,5H-Imidazo(1,2-a)quinazolin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4H-imidazo[1,2-a]quinazolin-5-one (CAS 109224-70-6) is a chemical compound with the molecular formula C10H7N3O and a molecular weight of 185.18 g/mol. IUPAC name: 4H-imidazo[1,2-a]quinazolin-5-one. InChIKey: JRWVZBAZGMBAMT-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 4H-imidazo[1,2-a]quinazolin-5-one |
| InChIKey | JRWVZBAZGMBAMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=NC=CN23 |
Computed by PubChem (NCBI)