Products 1092349-25-1
CAS 1092349-25-1 is the registry number for 6-Chloro-7-fluoro-3,4-dihydro-2H-1-benzopyran-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-7-fluoro-2,3-dihydrochromen-4-one (CAS 1092349-25-1) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: 6-chloro-7-fluoro-2,3-dihydrochromen-4-one. InChIKey: NCJQKDQIJMTYJK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | 6-chloro-7-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | NCJQKDQIJMTYJK-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C1=O)Cl)F |
Computed by PubChem (NCBI)