Products 1092350-94-1
CAS 1092350-94-1 is the registry number for 8-CHLORO-5-FLUOROCHROMAN-4-ONE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-chloro-5-fluoro-2,3-dihydrochromen-4-one (CAS 1092350-94-1) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: 8-chloro-5-fluoro-2,3-dihydrochromen-4-one. InChIKey: CPSAUOIYWLCFQQ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | 8-chloro-5-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | CPSAUOIYWLCFQQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2C1=O)F)Cl |
Computed by PubChem (NCBI)