Products 109310-99-8
CAS 109310-99-8 is the registry number for Antibacterial agent 122. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(benzylcarbamothioylamino)-2-hydroxybenzoic acid (CAS 109310-99-8) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: 4-(benzylcarbamothioylamino)-2-hydroxybenzoic acid. InChIKey: QFKSALQTLYBGJU-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 4-(benzylcarbamothioylamino)-2-hydroxybenzoic acid |
| InChIKey | QFKSALQTLYBGJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=S)NC2=CC(=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)