CAS 554407-09-9 is the registry number for 3-(2-Amino-1,3-thiazol-4-yl)-7-propoxy-2H-chromen-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2-amino-1,3-thiazol-4-yl)-7-propoxychromen-2-one (CAS 554407-09-9) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: 3-(2-amino-1,3-thiazol-4-yl)-7-propoxychromen-2-one. InChIKey: VTTGGDYEHGKXSI-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 3-(2-amino-1,3-thiazol-4-yl)-7-propoxychromen-2-one |
| InChIKey | VTTGGDYEHGKXSI-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)C=C(C(=O)O2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)