Products 2138840-99-8
CAS 2138840-99-8 is the registry number for 6-Methyl-1-tosyl-1,6-dihydro-7H-pyrrolo[2,3-c]pyridin-7-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one (CAS 2138840-99-8) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: 6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one. InChIKey: QKICOTLPAQCPPW-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one |
| InChIKey | QKICOTLPAQCPPW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C(=O)N(C=C3)C |
Computed by PubChem (NCBI)