CAS 1394306-56-9 appears in our catalog under these names: 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)(phenyl)amino]ethanol, 95%, 3-((2-Hydroxyethyl)(phenyl)amino)benzo(d)isothiazole 1,1-dioxide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 5g.
2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethanol (CAS 1394306-56-9) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethanol. InChIKey: WWGXXFWTQOFFLQ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)ethanol |
| InChIKey | WWGXXFWTQOFFLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(CCO)C2=NS(=O)(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)