CAS 1530308-87-2 appears in our catalog under these names: Febuxostat Impurity Z20, Febuxostat Impurity 15, Febuxostat Impurity 22, O-Desisobutyl-O-n-propyl Febuxostat, >95% (HPLC), 2-(3-Cyano-4-propoxyphenyl)-4-methylthiazole-5-carboxylic acid. Offered by: Chemat Brand, TRC, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 10mg, 250mg, 500mg, 25MG, 1g, 25 mg.
2-(3-cyano-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1530308-87-2) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: 2-(3-cyano-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: BWNYQPAKTQSUDL-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-(3-cyano-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | BWNYQPAKTQSUDL-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)O)C)C#N |
Computed by PubChem (NCBI)