CAS 1485081-57-9 appears in our catalog under these names: Belinostat Amide, Belinostat Impurity 4 (Belinostat Amide), Belinostat Amide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide (CAS 1485081-57-9) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: (E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide. InChIKey: LUVPQDAKKRMIOY-MDZDMXLPSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (E)-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide |
| InChIKey | LUVPQDAKKRMIOY-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)/C=C/C(=O)N |
Computed by PubChem (NCBI)