CAS 731816-85-6 is the registry number for 5-(3,4-Dimethoxyphenyl)-2-methyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(3,4-dimethoxyphenyl)-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 731816-85-6) is a chemical compound with the molecular formula C15H14N2O3S and a molecular weight of 302.4 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: FOXUMRCUZSOQHZ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3S |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | FOXUMRCUZSOQHZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CS2)C3=CC(=C(C=C3)OC)OC)C(=O)N1 |
Computed by PubChem (NCBI)