CAS 1093851-61-6 appears in our catalog under these names: Oseltamivir-d3, Oseltamivir–d3, Oseltamivir-d3, 99.13%. Offered by: Chemat Brand, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 1 mg.
Ethyl (3R,4R,5S)-5-amino-3-pentan-3-yloxy-4-[(2,2,2-trideuterioacetyl)amino]cyclohexene-1-carboxylate (CAS 1093851-61-6) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 315.42 g/mol. IUPAC name: ethyl (3R,4R,5S)-5-amino-3-pentan-3-yloxy-4-[(2,2,2-trideuterioacetyl)amino]cyclohexene-1-carboxylate. InChIKey: VSZGPKBBMSAYNT-RWPOTZPQSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 315.42 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-5-amino-3-pentan-3-yloxy-4-[(2,2,2-trideuterioacetyl)amino]cyclohexene-1-carboxylate |
| InChIKey | VSZGPKBBMSAYNT-RWPOTZPQSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H]1[C@H](CC(=C[C@H]1OC(CC)CC)C(=O)OCC)N |
Computed by PubChem (NCBI)