Products 2081110-44-1
CAS 2081110-44-1 is the registry number for (3S,4R,5R)-Oseltamivir. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3S,4R,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 2081110-44-1) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: ethyl (3S,4R,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: VSZGPKBBMSAYNT-QLFBSQMISA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | ethyl (3S,4R,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | VSZGPKBBMSAYNT-QLFBSQMISA-N |
| SMILES | CCC(CC)O[C@H]1C=C(C[C@H]([C@H]1NC(=O)C)N)C(=O)OCC |
Computed by PubChem (NCBI)