CAS 1373029-10-7 appears in our catalog under these names: Di-tert-butyl 6-methylene-1,4-diazepane-1,4-dicarboxylate, 95%, Di-tert-butyl 6-methylene-1,4-diazepane-1,4-dicarboxylate, 95+%, Di–tert–butyl 6–methylene–1,4–diazepane–1,4–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate (CAS 1373029-10-7) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate. InChIKey: GZYVFRGOAGIHKA-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | ditert-butyl 6-methylidene-1,4-diazepane-1,4-dicarboxylate |
| InChIKey | GZYVFRGOAGIHKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=C)C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)