Products 1330766-26-1
CAS 1330766-26-1 is the registry number for (3aR,8aR)-5-tert-butyl 8a-ethyl octahydropyrrolo[3,4-c]azepine-5,8a(1H)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-O-tert-butyl 8a-O-ethyl (3aR,8aR)-1,2,3,3a,4,6,7,8-octahydropyrrolo[3,4-c]azepine-5,8a-dicarboxylate (CAS 1330766-26-1) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: 5-O-tert-butyl 8a-O-ethyl (3aR,8aR)-1,2,3,3a,4,6,7,8-octahydropyrrolo[3,4-c]azepine-5,8a-dicarboxylate. InChIKey: ZLOQUTOOZGRYOE-WBMJQRKESA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | 5-O-tert-butyl 8a-O-ethyl (3aR,8aR)-1,2,3,3a,4,6,7,8-octahydropyrrolo[3,4-c]azepine-5,8a-dicarboxylate |
| InChIKey | ZLOQUTOOZGRYOE-WBMJQRKESA-N |
| SMILES | CCOC(=O)[C@]12CCCN(C[C@H]1CNC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)