Products 941296-96-4
CAS 941296-96-4 appears in our catalog under these names: Oseltamivir Impurity 132, Oseltamivir Impurity 145, Oseltamivir Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4S,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 941296-96-4) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: ethyl (3R,4S,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: VSZGPKBBMSAYNT-KFWWJZLASA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | ethyl (3R,4S,5R)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | VSZGPKBBMSAYNT-KFWWJZLASA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@H]([C@@H]1NC(=O)C)N)C(=O)OCC |
Computed by PubChem (NCBI)