Products 2413185-95-0
CAS 2413185-95-0 appears in our catalog under these names: (3R,4S,5S)-Oseltamivir, Oseltamivir Impurity 18, Oseltamivir Impurity 38. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Ethyl (3R,4S,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 2413185-95-0) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: ethyl (3R,4S,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: VSZGPKBBMSAYNT-ZNMIVQPWSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | ethyl (3R,4S,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | VSZGPKBBMSAYNT-ZNMIVQPWSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@@H]1NC(=O)C)N)C(=O)OCC |
Computed by PubChem (NCBI)