CAS 1822453-48-4 appears in our catalog under these names: 2-tert-Butyl 3-ethyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate, 95%, 2–tert–Butyl 3–ethyl 2,8–diazaspiro(4·5)decane–2,3–dicarboxylate, 2-(tert-Butyl) 3-ethyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate 97%, 2-(tert-Butyl) 3-ethyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-O-tert-butyl 3-O-ethyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate (CAS 1822453-48-4) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate. InChIKey: UIMVZWPYWOZZGY-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl 2,8-diazaspiro[4.5]decane-2,3-dicarboxylate |
| InChIKey | UIMVZWPYWOZZGY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2(CCNCC2)CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)