CAS 1094253-83-4 appears in our catalog under these names: 8,9-Dichloro-2,3,4,5-tetrahydro-1-benzoxepin-5-one, 95%, 8,9-Dichloro-2,3,4,5-tetrahydro-1-benzoxepin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
8,9-dichloro-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 1094253-83-4) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 8,9-dichloro-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: JPQBKYMLYPSYKX-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 8,9-dichloro-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | JPQBKYMLYPSYKX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C(=C(C=C2)Cl)Cl)OC1 |
Computed by PubChem (NCBI)