CAS 220353-04-8 is the registry number for (1R,2R)-2-(3,4-Dichlorophenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Trans-(1R,2R)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 220353-04-8) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: HNBMCAXNEUPDCW-NKWVEPMBSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | HNBMCAXNEUPDCW-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)