CAS 1453211-48-7 appears in our catalog under these names: 2,4-Dichloro-3-ethynyl-1,5-dimethoxybenzene, 95%, 2,4-Dichloro-3-ethynyl-1,5-dimethoxybenzene, 97%, 97%, 2,4-Dichloro-3-ethynyl-1,5-dimethoxybenzene, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2,4-dichloro-3-ethynyl-1,5-dimethoxybenzene (CAS 1453211-48-7) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 2,4-dichloro-3-ethynyl-1,5-dimethoxybenzene. InChIKey: ZGXDEQGKNWQYAD-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 2,4-dichloro-3-ethynyl-1,5-dimethoxybenzene |
| InChIKey | ZGXDEQGKNWQYAD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)C#C)Cl)OC |
Computed by PubChem (NCBI)