Products 209224-97-5
CAS 209224-97-5 is the registry number for 5,6-Dichloro-2,3-dihydro-1H-indene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-2,3-dihydro-1H-indene-2-carboxylic acid (CAS 209224-97-5) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 5,6-dichloro-2,3-dihydro-1H-indene-2-carboxylic acid. InChIKey: JYJHENDJPMLROB-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 5,6-dichloro-2,3-dihydro-1H-indene-2-carboxylic acid |
| InChIKey | JYJHENDJPMLROB-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC(=C(C=C21)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)