CAS 923178-14-7 appears in our catalog under these names: 4,6-Dichloro-7-hydroxy-3-methyl-2,3-dihydro-1H-inden-1-one, 95%, 4,6-Dichloro-7-hydroxy-3-methyl-2,3-dihydro-1H-inden-1-one 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
4,6-dichloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one (CAS 923178-14-7) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 4,6-dichloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one. InChIKey: XLNWOHSTQMVJCX-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 4,6-dichloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | XLNWOHSTQMVJCX-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C1C(=CC(=C2O)Cl)Cl |
Computed by PubChem (NCBI)