CAS 27164-07-4 is the registry number for 4-(Allyloxy)-3,5-dichlorobenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,5-dichloro-4-prop-2-enoxybenzaldehyde (CAS 27164-07-4) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 3,5-dichloro-4-prop-2-enoxybenzaldehyde. InChIKey: CJJQJAJJMMBMJT-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 3,5-dichloro-4-prop-2-enoxybenzaldehyde |
| InChIKey | CJJQJAJJMMBMJT-UHFFFAOYSA-N |
| SMILES | C=CCOC1=C(C=C(C=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)