Products 175168-68-0
CAS 175168-68-0 appears in our catalog under these names: (E)-3-(2,3-Dichlorophenyl)-2-propenoic acid, methyl ester, 98%, (E)-Methyl 3-(2,3-dichlorophenyl)acrylate, 98%, Methyl (2E)-3-(2,3-dichlorophenyl)prop-2-enoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 2,5g.
Methyl (E)-3-(2,3-dichlorophenyl)prop-2-enoate (CAS 175168-68-0) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: methyl (E)-3-(2,3-dichlorophenyl)prop-2-enoate. InChIKey: LNCHVNAJMWMKCG-AATRIKPKSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | methyl (E)-3-(2,3-dichlorophenyl)prop-2-enoate |
| InChIKey | LNCHVNAJMWMKCG-AATRIKPKSA-N |
| SMILES | COC(=O)/C=C/C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)