CAS 1094325-06-0 is the registry number for 2-(Pyridin-3-yloxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-pyridin-3-yloxybenzoic acid (CAS 1094325-06-0) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-pyridin-3-yloxybenzoic acid. InChIKey: CVDCJGITZQGDJF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-pyridin-3-yloxybenzoic acid |
| InChIKey | CVDCJGITZQGDJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CN=CC=C2 |
Computed by PubChem (NCBI)