CAS 1094536-97-6 appears in our catalog under these names: 4-(2,2,2-trifluoroethoxy)benzene-1-sulfonamide, 95%, 4-(2,2,2-Trifluoroethoxy)benzene-1-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
4-(2,2,2-trifluoroethoxy)benzenesulfonamide (CAS 1094536-97-6) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)benzenesulfonamide. InChIKey: NUCKSSOHQHRRAQ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| InChIKey | NUCKSSOHQHRRAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(F)(F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)