CAS 1589523-29-4 is the registry number for 2-Amino-3-methylphenyl trifluoromethanesulphonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-amino-3-methylphenyl) trifluoromethanesulfonate (CAS 1589523-29-4) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: (2-amino-3-methylphenyl) trifluoromethanesulfonate. InChIKey: AJDLUZWNMXCSLE-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | (2-amino-3-methylphenyl) trifluoromethanesulfonate |
| InChIKey | AJDLUZWNMXCSLE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OS(=O)(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)