CAS 1197469-61-6 appears in our catalog under these names: 4,4,4-Trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoic acid, 95%, 4,4,4-Trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoic acid (CAS 1197469-61-6) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: 4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoic acid. InChIKey: HSKUOTMNACHDPJ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-hydroxy-3-(4-methyl-1,3-thiazol-2-yl)butanoic acid |
| InChIKey | HSKUOTMNACHDPJ-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C(CC(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)