Products 1601116-04-4
CAS 1601116-04-4 is the registry number for 4-(Methoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid (CAS 1601116-04-4) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: 4-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: PYRFZZLYPHMANK-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 4-(methoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | PYRFZZLYPHMANK-UHFFFAOYSA-N |
| SMILES | COCC1=C(SC(=N1)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)