CAS 1820706-98-6 is the registry number for 3-Amino-2-methylphenyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-amino-2-methylphenyl) trifluoromethanesulfonate (CAS 1820706-98-6) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: (3-amino-2-methylphenyl) trifluoromethanesulfonate. InChIKey: CCISASOLGXQFEM-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | (3-amino-2-methylphenyl) trifluoromethanesulfonate |
| InChIKey | CCISASOLGXQFEM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1OS(=O)(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)