Products 2201926-53-4
CAS 2201926-53-4 is the registry number for (2-(Trifluoromethyl)pyridin-4-yl)methyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(trifluoromethyl)-4-pyridinyl]methyl methanesulfonate (CAS 2201926-53-4) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: [2-(trifluoromethyl)-4-pyridinyl]methyl methanesulfonate. InChIKey: GEZIYEYQPKUHTD-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | [2-(trifluoromethyl)-4-pyridinyl]methyl methanesulfonate |
| InChIKey | GEZIYEYQPKUHTD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1=CC(=NC=C1)C(F)(F)F |
Computed by PubChem (NCBI)