CAS 1261683-36-6 appears in our catalog under these names: 5-Methyl-2-(trifluoromethoxy)benzenesulfonamide, 95%, 5-Methyl-2-(trifluoromethoxy)benzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
5-methyl-2-(trifluoromethoxy)benzenesulfonamide (CAS 1261683-36-6) is a chemical compound with the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. IUPAC name: 5-methyl-2-(trifluoromethoxy)benzenesulfonamide. InChIKey: HNLZBJUMEALPAO-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3S |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 5-methyl-2-(trifluoromethoxy)benzenesulfonamide |
| InChIKey | HNLZBJUMEALPAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(F)(F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)