CAS 109486-09-1 appears in our catalog under these names: 5-Bromo-2-methoxybenzene-1,3-dicarbaldehyde, 95%, 5-Bromo-2-methoxybenzene-1,3-dicarbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-2-methoxybenzene-1,3-dicarbaldehyde (CAS 109486-09-1) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 5-bromo-2-methoxybenzene-1,3-dicarbaldehyde. InChIKey: PLGQWZJIJNUBEW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzene-1,3-dicarbaldehyde |
| InChIKey | PLGQWZJIJNUBEW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C=O)Br)C=O |
Computed by PubChem (NCBI)