Products 1095051-68-5
CAS 1095051-68-5 appears in our catalog under these names: 4-(3-Chlorophenyl)-2,3-dihydro-1,3-thiazol-2-one, 95%, BRD4 Inhibitor-34, 95%, 4-(3-Chlorophenyl)-2(3H)-thiazolone/ 95%, 4-(3-chlorophenyl)-2,3-dihydro-1,3-thiazol-2-one, BRD4 Inhibitor-34. Offered by: Combi-blocks, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 5mg, 10mg, 25mg.
4-(3-chlorophenyl)-3H-1,3-thiazol-2-one (CAS 1095051-68-5) is a chemical compound with the molecular formula C9H6ClNOS and a molecular weight of 211.67 g/mol. IUPAC name: 4-(3-chlorophenyl)-3H-1,3-thiazol-2-one. InChIKey: JSSIKAYQGBLIBU-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNOS |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-3H-1,3-thiazol-2-one |
| InChIKey | JSSIKAYQGBLIBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CSC(=O)N2 |
Computed by PubChem (NCBI)